Products 1858251-26-9

CAS 1858251-26-9 is the registry number for 6-Fluoropyridine-3-carbonyl fluoride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

6-fluoropyridine-3-carbonyl fluoride (CAS 1858251-26-9) is a chemical compound with the molecular formula C6H3F2NO and a molecular weight of 143.09 g/mol. IUPAC name: 6-fluoropyridine-3-carbonyl fluoride. InChIKey: RMZGKMOTICMPDI-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3F2NO
Molecular weight143.09 g/mol
IUPAC name6-fluoropyridine-3-carbonyl fluoride
InChIKeyRMZGKMOTICMPDI-UHFFFAOYSA-N
SMILESC1=CC(=NC=C1C(=O)F)F

Computed by PubChem (NCBI)