CAS 1858251-84-9 is the registry number for Methyl 2,5-difluoro-4-(4-methylpiperazin-1-yl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 2,5-difluoro-4-(4-methylpiperazin-1-yl)benzoate (CAS 1858251-84-9) is a chemical compound with the molecular formula C13H16F2N2O2 and a molecular weight of 270.27 g/mol. IUPAC name: methyl 2,5-difluoro-4-(4-methylpiperazin-1-yl)benzoate. InChIKey: TUMHCAVQFOKDHD-UHFFFAOYSA-N.
| Molecular formula | C13H16F2N2O2 |
|---|---|
| Molecular weight | 270.27 g/mol |
| IUPAC name | methyl 2,5-difluoro-4-(4-methylpiperazin-1-yl)benzoate |
| InChIKey | TUMHCAVQFOKDHD-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=C(C(=C2)F)C(=O)OC)F |
Computed by PubChem (NCBI)