Products 1858255-92-1

CAS 1858255-92-1 is the registry number for 4-[4-Nitro-2-(trifluoromethyl)phenoxy]benzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

4-[4-nitro-2-(trifluoromethyl)phenoxy]benzenesulfonyl chloride (CAS 1858255-92-1) is a chemical compound with the molecular formula C13H7ClF3NO5S and a molecular weight of 381.71 g/mol. IUPAC name: 4-[4-nitro-2-(trifluoromethyl)phenoxy]benzenesulfonyl chloride. InChIKey: LMTSUESAKDHFQL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H7ClF3NO5S
Molecular weight381.71 g/mol
IUPAC name4-[4-nitro-2-(trifluoromethyl)phenoxy]benzenesulfonyl chloride
InChIKeyLMTSUESAKDHFQL-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1OC2=C(C=C(C=C2)[N+](=O)[O-])C(F)(F)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)