CAS 1858890-66-0 is the registry number for 3-((5-Amino-4H-1,2,4-triazol-3-yl)amino)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-N-(1,1-dioxothietan-3-yl)-1H-1,2,4-triazole-3,5-diamine (CAS 1858890-66-0) is a chemical compound with the molecular formula C5H9N5O2S and a molecular weight of 203.23 g/mol. IUPAC name: 3-N-(1,1-dioxothietan-3-yl)-1H-1,2,4-triazole-3,5-diamine. InChIKey: NVRBLODRYVWGLZ-UHFFFAOYSA-N.
| Molecular formula | C5H9N5O2S |
|---|---|
| Molecular weight | 203.23 g/mol |
| IUPAC name | 3-N-(1,1-dioxothietan-3-yl)-1H-1,2,4-triazole-3,5-diamine |
| InChIKey | NVRBLODRYVWGLZ-UHFFFAOYSA-N |
| SMILES | C1C(CS1(=O)=O)NC2=NNC(=N2)N |
Computed by PubChem (NCBI)