CAS 18596-11-7 is the registry number for 9-Amino-7a,8,10-triaza-cyclopenta[a]phenalen-7-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
12-amino-11,13,14-triazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),6,8,10,12-heptaen-15-one (CAS 18596-11-7) is a chemical compound with the molecular formula C13H8N4O and a molecular weight of 236.23 g/mol. IUPAC name: 12-amino-11,13,14-triazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),6,8,10,12-heptaen-15-one. InChIKey: KDPOKPRIXXYGCF-UHFFFAOYSA-N.
| Molecular formula | C13H8N4O |
|---|---|
| Molecular weight | 236.23 g/mol |
| IUPAC name | 12-amino-11,13,14-triazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),6,8,10,12-heptaen-15-one |
| InChIKey | KDPOKPRIXXYGCF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C4=NC(=NN4C(=O)C3=CC=C2)N |
Computed by PubChem (NCBI)