CAS 185990-03-8 appears in our catalog under these names: (Dimethylphenylsilyl)boronic acid pinacol ester, 95%, (Dimethylphenylsilyl)boronic acid pinacol ester, 95% NMR, 2-(Dimethylphenylsilyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(Dimethylphenylsilyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >95.0%(GC), (DIMETHYLPHENYLSILYL)BORONIC ACID PINACO. Offered by: Combi-blocks, AmBeed, Biosynth, TCI, Sigma-Aldrich. Available pack sizes: 5g, 25g, 10g, 1g, 500mg, 250mg, 1000mg, 2000mg.
Dimethyl-phenyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane (CAS 185990-03-8) is a chemical compound with the molecular formula C14H23BO2Si and a molecular weight of 262.23 g/mol. IUPAC name: dimethyl-phenyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane. InChIKey: ARMSAQNLTKGMGM-UHFFFAOYSA-N.
| Molecular formula | C14H23BO2Si |
|---|---|
| Molecular weight | 262.23 g/mol |
| IUPAC name | dimethyl-phenyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane |
| InChIKey | ARMSAQNLTKGMGM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)[Si](C)(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)