Products 185990-36-7
CAS 185990-36-7 appears in our catalog under these names: N,N-Dimethyl-d6-formamide, 99 atom % D, min 98% Chemical Purity, N,N-DIMETHYL-D6-FORMAMIDE, >=98 ATOM %. Offered by: CDN, Sigma-Aldrich. Available pack sizes: 1g, 0,5g, 5G.
N,N-bis(trideuteriomethyl)formamide (CAS 185990-36-7) is a chemical compound with the molecular formula C3H7NO and a molecular weight of 79.13 g/mol. IUPAC name: N,N-bis(trideuteriomethyl)formamide. InChIKey: ZMXDDKWLCZADIW-WFGJKAKNSA-N.
| Molecular formula | C3H7NO |
|---|---|
| Molecular weight | 79.13 g/mol |
| IUPAC name | N,N-bis(trideuteriomethyl)formamide |
| InChIKey | ZMXDDKWLCZADIW-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(C=O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)