CAS 185997-26-6 is the registry number for Secalciferol Related Compound 3. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,3aR,7aR)-1-[(2S)-1-hydroxypropan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (CAS 185997-26-6) is a chemical compound with the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. IUPAC name: (1R,3aR,7aR)-1-[(2S)-1-hydroxypropan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol. InChIKey: FUBPRYXDIHQLGH-OCIKQUFWSA-N.
| Molecular formula | C13H24O2 |
|---|---|
| Molecular weight | 212.33 g/mol |
| IUPAC name | (1R,3aR,7aR)-1-[(2S)-1-hydroxypropan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| InChIKey | FUBPRYXDIHQLGH-OCIKQUFWSA-N |
| SMILES | C[C@H](CO)[C@H]1CC[C@@H]2[C@@]1(CCCC2O)C |
Computed by PubChem (NCBI)