CAS 1860005-05-5 appears in our catalog under these names: 3-Chloro-4-(cyclopropylmethoxy)phenylboronic acid, pinacol ester, 98%, 98%, 2-(3-Chloro-4-(cyclopropylmethoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
2-[3-chloro-4-(cyclopropylmethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1860005-05-5) is a chemical compound with the molecular formula C16H22BClO3 and a molecular weight of 308.6 g/mol. IUPAC name: 2-[3-chloro-4-(cyclopropylmethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XZLSZGLEDCVXBM-UHFFFAOYSA-N.
| Molecular formula | C16H22BClO3 |
|---|---|
| Molecular weight | 308.6 g/mol |
| IUPAC name | 2-[3-chloro-4-(cyclopropylmethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XZLSZGLEDCVXBM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OCC3CC3)Cl |
Computed by PubChem (NCBI)