CAS 1860028-26-7 is the registry number for Methyl 3-[(3-aminocyclobutanecarbonyl)amino]cyclobutanecarboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 3-[(3-aminocyclobutanecarbonyl)amino]cyclobutane-1-carboxylate;dihydrochloride (CAS 1860028-26-7) is a chemical compound with the molecular formula C11H20Cl2N2O3 and a molecular weight of 299.19 g/mol. IUPAC name: methyl 3-[(3-aminocyclobutanecarbonyl)amino]cyclobutane-1-carboxylate;dihydrochloride. InChIKey: BDCJXEPEULQJPW-UHFFFAOYSA-N.
| Molecular formula | C11H20Cl2N2O3 |
|---|---|
| Molecular weight | 299.19 g/mol |
| IUPAC name | methyl 3-[(3-aminocyclobutanecarbonyl)amino]cyclobutane-1-carboxylate;dihydrochloride |
| InChIKey | BDCJXEPEULQJPW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC(C1)NC(=O)C2CC(C2)N.Cl.Cl |
Computed by PubChem (NCBI)