CAS 18602-85-2 is the registry number for Tris(trimethylsilyl)guanine. Offered by: TRC. Available pack sizes: 10g, 25g, 5g.
N,9-bis(trimethylsilyl)-6-trimethylsilyloxypurin-2-amine (CAS 18602-85-2) is a chemical compound with the molecular formula C14H29N5OSi3 and a molecular weight of 367.67 g/mol. IUPAC name: N,9-bis(trimethylsilyl)-6-trimethylsilyloxypurin-2-amine. InChIKey: ZTKRDVGMYXNNJL-UHFFFAOYSA-N.
| Molecular formula | C14H29N5OSi3 |
|---|---|
| Molecular weight | 367.67 g/mol |
| IUPAC name | N,9-bis(trimethylsilyl)-6-trimethylsilyloxypurin-2-amine |
| InChIKey | ZTKRDVGMYXNNJL-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)NC1=NC2=C(C(=N1)O[Si](C)(C)C)N=CN2[Si](C)(C)C |
Computed by PubChem (NCBI)