CAS 186020-66-6 appears in our catalog under these names: tert-Butyl 12-hydroxy-4,7,10-trioxadodecanoate, 97%, Hydroxy–PEG3–(CH2)2–Boc, tert-Butyl 12-Hydroxy-4,7,10-trioxadodecanoate, >97.0%(GC), Hydroxy-PEG3-(CH2)2-Boc 97%, TERT-BUTYL 12-HYDROXY-4,7,10-TRIOXADODE&. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 25g, 5g, 10g, 1g, 500mg, 500g, 250mg, 100g.
Tert-butyl 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propanoate (CAS 186020-66-6) is a chemical compound with the molecular formula C13H26O6 and a molecular weight of 278.34 g/mol. IUPAC name: tert-butyl 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propanoate. InChIKey: KSXVEOLRERRELV-UHFFFAOYSA-N.
| Molecular formula | C13H26O6 |
|---|---|
| Molecular weight | 278.34 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propanoate |
| InChIKey | KSXVEOLRERRELV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCO |
Computed by PubChem (NCBI)