CAS 1860779-42-5 appears in our catalog under these names: Tyrosinase–IN–12, Tyrosinase-IN-12, 98%, Tyrosinase-IN-12/ 99.49% (existing batch purity), Tyrosinase-IN-12 98%, (E)-2-(2-(4-chlorobenzylidene)hydrazineyl)-4-phenylthiazole, 95%, 95%. Offered by: GLPBio, AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
N-[(E)-(4-chlorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine (CAS 1860779-42-5) is a chemical compound with the molecular formula C16H12ClN3S and a molecular weight of 313.8 g/mol. IUPAC name: N-[(E)-(4-chlorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine. InChIKey: YQKYELGBAMTOTP-VCHYOVAHSA-N.
| Molecular formula | C16H12ClN3S |
|---|---|
| Molecular weight | 313.8 g/mol |
| IUPAC name | N-[(E)-(4-chlorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| InChIKey | YQKYELGBAMTOTP-VCHYOVAHSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)N/N=C/C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)