Products 186086-10-2
CAS 186086-10-2 is the registry number for HNS-32. Offered by: MedChemExpress. Available pack sizes: Get quote.
N,N,3,8-tetramethyl-5-propan-2-yl-N'-(pyridin-2-ylmethyl)azulene-1-carboximidamide (CAS 186086-10-2) is a chemical compound with the molecular formula C24H29N3 and a molecular weight of 359.5 g/mol. IUPAC name: N,N,3,8-tetramethyl-5-propan-2-yl-N'-(pyridin-2-ylmethyl)azulene-1-carboximidamide. InChIKey: VKDSEWRXCPKODE-UHFFFAOYSA-N.
| Molecular formula | C24H29N3 |
|---|---|
| Molecular weight | 359.5 g/mol |
| IUPAC name | N,N,3,8-tetramethyl-5-propan-2-yl-N'-(pyridin-2-ylmethyl)azulene-1-carboximidamide |
| InChIKey | VKDSEWRXCPKODE-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC(=C2C=C(C=C1)C(C)C)C)C(=NCC3=CC=CC=N3)N(C)C |
Computed by PubChem (NCBI)