CAS 186185-03-5 appears in our catalog under these names: BMS-193885, 99%, BMS-193885, BMS-193885 99%, BMS 193885, 99%, 99%, BMS-193885, 99.91%. Offered by: AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM/1mL.
Dimethyl 4-[3-[3-[4-(3-methoxyphenyl)piperidin-1-yl]propylcarbamoylamino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 186185-03-5) is a chemical compound with the molecular formula C33H42N4O6 and a molecular weight of 590.7 g/mol. IUPAC name: dimethyl 4-[3-[3-[4-(3-methoxyphenyl)piperidin-1-yl]propylcarbamoylamino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: WMYSXJSJXZFODY-UHFFFAOYSA-N.
| Molecular formula | C33H42N4O6 |
|---|---|
| Molecular weight | 590.7 g/mol |
| IUPAC name | dimethyl 4-[3-[3-[4-(3-methoxyphenyl)piperidin-1-yl]propylcarbamoylamino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | WMYSXJSJXZFODY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC)C2=CC(=CC=C2)NC(=O)NCCCN3CCC(CC3)C4=CC(=CC=C4)OC)C(=O)OC |
Computed by PubChem (NCBI)