CAS 1862239-04-0 appears in our catalog under these names: 4,4'–(Benzo(c)(1,2,5)selenadiazole–4,7–diyl)dibenzoicacid, 4,4'-(Benzo[c][1,2,5]selenadiazole-4,7-diyl)dibenzoic acid, 98%, 98%, 4,4'-(Benzo[c][1,2,5]selenadiazole-4,7-diyl)dibenzoic acid, 98%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 1g, 100mg, 250mg.
4-[4-(4-carboxyphenyl)-2,1,3-benzoselenadiazol-7-yl]benzoic acid (CAS 1862239-04-0) is a chemical compound with the molecular formula C20H12N2O4Se and a molecular weight of 423.3 g/mol. IUPAC name: 4-[4-(4-carboxyphenyl)-2,1,3-benzoselenadiazol-7-yl]benzoic acid. InChIKey: PYSCBHFDFRYDNG-UHFFFAOYSA-N.
| Molecular formula | C20H12N2O4Se |
|---|---|
| Molecular weight | 423.3 g/mol |
| IUPAC name | 4-[4-(4-carboxyphenyl)-2,1,3-benzoselenadiazol-7-yl]benzoic acid |
| InChIKey | PYSCBHFDFRYDNG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C3=N[Se]N=C23)C4=CC=C(C=C4)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)