CAS 1862652-07-0 is the registry number for 5-Cyclopropyl-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-cyclopropyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-amine (CAS 1862652-07-0) is a chemical compound with the molecular formula C9H13N3S and a molecular weight of 195.29 g/mol. IUPAC name: 5-cyclopropyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-amine. InChIKey: LMZUJESUXNEBTJ-UHFFFAOYSA-N.
| Molecular formula | C9H13N3S |
|---|---|
| Molecular weight | 195.29 g/mol |
| IUPAC name | 5-cyclopropyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-amine |
| InChIKey | LMZUJESUXNEBTJ-UHFFFAOYSA-N |
| SMILES | C1CC1N2CCC3=C(C2)SC(=N3)N |
Computed by PubChem (NCBI)