CAS 18631-22-6 is the registry number for 5H-Indeno[1,2-c]pyridin-5-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Indeno[1,2-c]pyridin-5-one (CAS 18631-22-6) is a chemical compound with the molecular formula C12H7NO and a molecular weight of 181.19 g/mol. IUPAC name: indeno[1,2-c]pyridin-5-one. InChIKey: FVUGGEIGQCQEBB-UHFFFAOYSA-N.
| Molecular formula | C12H7NO |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | indeno[1,2-c]pyridin-5-one |
| InChIKey | FVUGGEIGQCQEBB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)C=CN=C3 |
Computed by PubChem (NCBI)