CAS 18633-05-1 appears in our catalog under these names: 6,7-Dibromoquinoline-5,8-dione, 95%, 95%, 6,7-Dibromoquinoline-5,8-dione, 95.48%, 6,7-Dibromoquinoline-5,8-dione, 95%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 100 mg, 500 mg, 1 g, 25 mg, 250 mg.
6,7-dibromoquinoline-5,8-dione (CAS 18633-05-1) is a chemical compound with the molecular formula C9H3Br2NO2 and a molecular weight of 316.93 g/mol. IUPAC name: 6,7-dibromoquinoline-5,8-dione. InChIKey: CPZKOUMVYNIHQE-UHFFFAOYSA-N.
| Molecular formula | C9H3Br2NO2 |
|---|---|
| Molecular weight | 316.93 g/mol |
| IUPAC name | 6,7-dibromoquinoline-5,8-dione |
| InChIKey | CPZKOUMVYNIHQE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=O)C(=C(C2=O)Br)Br)N=C1 |
Computed by PubChem (NCBI)