CAS 186354-46-1 appears in our catalog under these names: 1,3-Bis((R)-1-phenylethyl)-1H-imidazol-3-ium chloride 97%, 1,3-Bis((R)-1-phenylethyl)-1H-imidazol-3-ium chloride, 97%, 97%, 1,3-Bis((R)-1-phenylethyl)-1H-imidazol-3-ium chloride, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
1,3-bis[(1R)-1-phenylethyl]imidazol-1-ium chloride (CAS 186354-46-1) is a chemical compound with the molecular formula C19H21ClN2 and a molecular weight of 312.8 g/mol. IUPAC name: 1,3-bis[(1R)-1-phenylethyl]imidazol-1-ium chloride. InChIKey: XGJRZQHDLLMQMR-GBNZRNLASA-M.
| Molecular formula | C19H21ClN2 |
|---|---|
| Molecular weight | 312.8 g/mol |
| IUPAC name | 1,3-bis[(1R)-1-phenylethyl]imidazol-1-ium chloride |
| InChIKey | XGJRZQHDLLMQMR-GBNZRNLASA-M |
| SMILES | C[C@H](C1=CC=CC=C1)N2C=C[N+](=C2)[C@H](C)C3=CC=CC=C3.[Cl-] |
Computed by PubChem (NCBI)