CAS 186390-63-6 is the registry number for 7-Bromo-6-nitro-n-tert-butoxycarbonyl-1,2,3,4-tetrahydroisoquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 7-bromo-6-nitro-3,4-dihydro-1H-isoquinoline-2-carboxylate (CAS 186390-63-6) is a chemical compound with the molecular formula C14H17BrN2O4 and a molecular weight of 357.20 g/mol. IUPAC name: tert-butyl 7-bromo-6-nitro-3,4-dihydro-1H-isoquinoline-2-carboxylate. InChIKey: RVAPXPOTRYDTJS-UHFFFAOYSA-N.
| Molecular formula | C14H17BrN2O4 |
|---|---|
| Molecular weight | 357.20 g/mol |
| IUPAC name | tert-butyl 7-bromo-6-nitro-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| InChIKey | RVAPXPOTRYDTJS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=CC(=C(C=C2C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)