CAS 186392-40-5 appears in our catalog under these names: CP–91149, CP-91149, CP-91149, >95% (HPLC), CP-91149/ 99.81% (existing batch purity), CP 91149. Offered by: GLPBio, Chemat Brand, TRC, TargetMol, Biosynth. Available pack sizes: 5mg, on request, 100mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 0,25g.
5-chloro-N-[(2S,3R)-4-(dimethylamino)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]-1H-indole-2-carboxamide (CAS 186392-40-5) is a chemical compound with the molecular formula C21H22ClN3O3 and a molecular weight of 399.9 g/mol. IUPAC name: 5-chloro-N-[(2S,3R)-4-(dimethylamino)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]-1H-indole-2-carboxamide. InChIKey: HINJNZFCMLSBCI-PKOBYXMFSA-N.
| Molecular formula | C21H22ClN3O3 |
|---|---|
| Molecular weight | 399.9 g/mol |
| IUPAC name | 5-chloro-N-[(2S,3R)-4-(dimethylamino)-3-hydroxy-4-oxo-1-phenylbutan-2-yl]-1H-indole-2-carboxamide |
| InChIKey | HINJNZFCMLSBCI-PKOBYXMFSA-N |
| SMILES | CN(C)C(=O)[C@@H]([C@H](CC1=CC=CC=C1)NC(=O)C2=CC3=C(N2)C=CC(=C3)Cl)O |
Computed by PubChem (NCBI)