CAS 1864003-24-6 appears in our catalog under these names: (3R,4S)-3,4-Difluoropyrrolidine trifluoroacetic acid, 95%, rac-(3R,4S)-3,4-Difluoropyrrolidine, trifluoroacetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 2,5g.
(3R,4S)-3,4-difluoropyrrolidine;2,2,2-trifluoroacetic acid (CAS 1864003-24-6) is a chemical compound with the molecular formula C6H8F5NO2 and a molecular weight of 221.13 g/mol. IUPAC name: (3R,4S)-3,4-difluoropyrrolidine;2,2,2-trifluoroacetic acid. InChIKey: WIQGNMFTBPHCOH-HKTIBRIUSA-N.
| Molecular formula | C6H8F5NO2 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | (3R,4S)-3,4-difluoropyrrolidine;2,2,2-trifluoroacetic acid |
| InChIKey | WIQGNMFTBPHCOH-HKTIBRIUSA-N |
| SMILES | C1[C@H]([C@H](CN1)F)F.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)