CAS 1864014-99-2 is the registry number for (2,2-Dichloro-1-methylcyclopropyl)methanesulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2,2-dichloro-1-methylcyclopropyl)methanesulfonyl chloride (CAS 1864014-99-2) is a chemical compound with the molecular formula C5H7Cl3O2S and a molecular weight of 237.5 g/mol. IUPAC name: (2,2-dichloro-1-methylcyclopropyl)methanesulfonyl chloride. InChIKey: ASMWVTDIWQFWGT-UHFFFAOYSA-N.
| Molecular formula | C5H7Cl3O2S |
|---|---|
| Molecular weight | 237.5 g/mol |
| IUPAC name | (2,2-dichloro-1-methylcyclopropyl)methanesulfonyl chloride |
| InChIKey | ASMWVTDIWQFWGT-UHFFFAOYSA-N |
| SMILES | CC1(CC1(Cl)Cl)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)