Products 1864015-10-0
CAS 1864015-10-0 appears in our catalog under these names: 2-(1-Aminoethyl)pyrimidin-4-amine dihydrochloride, 95%, 2-(1-Aminoethyl)pyrimidin-4-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(1-aminoethyl)pyrimidin-4-amine;dihydrochloride (CAS 1864015-10-0) is a chemical compound with the molecular formula C6H12Cl2N4 and a molecular weight of 211.09 g/mol. IUPAC name: 2-(1-aminoethyl)pyrimidin-4-amine;dihydrochloride. InChIKey: NMOIIOSBRZSCJN-UHFFFAOYSA-N.
| Molecular formula | C6H12Cl2N4 |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | 2-(1-aminoethyl)pyrimidin-4-amine;dihydrochloride |
| InChIKey | NMOIIOSBRZSCJN-UHFFFAOYSA-N |
| SMILES | CC(C1=NC=CC(=N1)N)N.Cl.Cl |
Computed by PubChem (NCBI)