CAS 1864015-13-3 is the registry number for ethyl 2-amino-4-(4-bromophenyl)-1,3-thiazole-5-carboxylate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
Ethyl 2-amino-4-(4-bromophenyl)-1,3-thiazole-5-carboxylate;hydrochloride (CAS 1864015-13-3) is a chemical compound with the molecular formula C12H12BrClN2O2S and a molecular weight of 363.66 g/mol. IUPAC name: ethyl 2-amino-4-(4-bromophenyl)-1,3-thiazole-5-carboxylate;hydrochloride. InChIKey: PPMBLWCJIZGRMG-UHFFFAOYSA-N.
| Molecular formula | C12H12BrClN2O2S |
|---|---|
| Molecular weight | 363.66 g/mol |
| IUPAC name | ethyl 2-amino-4-(4-bromophenyl)-1,3-thiazole-5-carboxylate;hydrochloride |
| InChIKey | PPMBLWCJIZGRMG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)N)C2=CC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)