CAS 1864016-10-3 is the registry number for 1,2-Di(2-chloro-4-fluorophenyl)ethane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-chloro-1-[2-(2-chloro-4-fluorophenyl)ethyl]-4-fluorobenzene (CAS 1864016-10-3) is a chemical compound with the molecular formula C14H10Cl2F2 and a molecular weight of 287.1 g/mol. IUPAC name: 2-chloro-1-[2-(2-chloro-4-fluorophenyl)ethyl]-4-fluorobenzene. InChIKey: SCJJWXRPVOQFNQ-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2F2 |
|---|---|
| Molecular weight | 287.1 g/mol |
| IUPAC name | 2-chloro-1-[2-(2-chloro-4-fluorophenyl)ethyl]-4-fluorobenzene |
| InChIKey | SCJJWXRPVOQFNQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)CCC2=C(C=C(C=C2)F)Cl |
Computed by PubChem (NCBI)