CAS 1864056-29-0 is the registry number for 2-Fluoro-5-hydrazinylbenzoic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-fluoro-5-hydrazinylbenzoic acid;dihydrochloride (CAS 1864056-29-0) is a chemical compound with the molecular formula C7H9Cl2FN2O2 and a molecular weight of 243.06 g/mol. IUPAC name: 2-fluoro-5-hydrazinylbenzoic acid;dihydrochloride. InChIKey: PDEGIORUXKNHBP-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2FN2O2 |
|---|---|
| Molecular weight | 243.06 g/mol |
| IUPAC name | 2-fluoro-5-hydrazinylbenzoic acid;dihydrochloride |
| InChIKey | PDEGIORUXKNHBP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NN)C(=O)O)F.Cl.Cl |
Computed by PubChem (NCBI)