CAS 1864058-51-4 is the registry number for 1-(5,6-Dichloro-1H-1,3-benzodiazol-2-yl)ethan-1-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(5,6-dichloro-1H-benzimidazol-2-yl)ethanamine;dihydrochloride (CAS 1864058-51-4) is a chemical compound with the molecular formula C9H11Cl4N3 and a molecular weight of 303.0 g/mol. IUPAC name: 1-(5,6-dichloro-1H-benzimidazol-2-yl)ethanamine;dihydrochloride. InChIKey: UUPTWDUHEXVXHW-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl4N3 |
|---|---|
| Molecular weight | 303.0 g/mol |
| IUPAC name | 1-(5,6-dichloro-1H-benzimidazol-2-yl)ethanamine;dihydrochloride |
| InChIKey | UUPTWDUHEXVXHW-UHFFFAOYSA-N |
| SMILES | CC(C1=NC2=CC(=C(C=C2N1)Cl)Cl)N.Cl.Cl |
Computed by PubChem (NCBI)