CAS 1864058-93-4 appears in our catalog under these names: 3,7-Dibromo-6-hydroxy-2-naphthyl acetate, 95%, 3,7–Dibromo–6–hydroxy–2–naphthyl Acetate, 3,7-Dibromo-6-hydroxy-2-naphthyl Acetate, ≥95%, ≥95%, 3,7-Dibromo-6-hydroxynaphthalen-2-yl acetate, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
(3,7-dibromo-6-hydroxynaphthalen-2-yl) acetate (CAS 1864058-93-4) is a chemical compound with the molecular formula C12H8Br2O3 and a molecular weight of 360.00 g/mol. IUPAC name: (3,7-dibromo-6-hydroxynaphthalen-2-yl) acetate. InChIKey: OWBFXRUWPRPNTD-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2O3 |
|---|---|
| Molecular weight | 360.00 g/mol |
| IUPAC name | (3,7-dibromo-6-hydroxynaphthalen-2-yl) acetate |
| InChIKey | OWBFXRUWPRPNTD-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=CC(=C(C=C2C=C1Br)O)Br |
Computed by PubChem (NCBI)