CAS 1864061-46-0 is the registry number for 2-((4-Fluorophenyl)methyl)-1H-1,3-benzodiazol-5-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-[(4-fluorophenyl)methyl]-3H-benzimidazol-5-amine;dihydrochloride (CAS 1864061-46-0) is a chemical compound with the molecular formula C14H14Cl2FN3 and a molecular weight of 314.2 g/mol. IUPAC name: 2-[(4-fluorophenyl)methyl]-3H-benzimidazol-5-amine;dihydrochloride. InChIKey: CXKHMOOVJHKCJZ-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl2FN3 |
|---|---|
| Molecular weight | 314.2 g/mol |
| IUPAC name | 2-[(4-fluorophenyl)methyl]-3H-benzimidazol-5-amine;dihydrochloride |
| InChIKey | CXKHMOOVJHKCJZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=NC3=C(N2)C=C(C=C3)N)F.Cl.Cl |
Computed by PubChem (NCBI)