Products 1864062-03-2
CAS 1864062-03-2 is the registry number for 4-Methyl-2-{(1-(propan-2-yl)-1H-pyrazol-3-yl)methyl}pentanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-methyl-2-[(1-propan-2-ylpyrazol-3-yl)methyl]pentanoic acid;hydrochloride (CAS 1864062-03-2) is a chemical compound with the molecular formula C13H23ClN2O2 and a molecular weight of 274.79 g/mol. IUPAC name: 4-methyl-2-[(1-propan-2-ylpyrazol-3-yl)methyl]pentanoic acid;hydrochloride. InChIKey: OVFFVXSEFWSKSF-UHFFFAOYSA-N.
| Molecular formula | C13H23ClN2O2 |
|---|---|
| Molecular weight | 274.79 g/mol |
| IUPAC name | 4-methyl-2-[(1-propan-2-ylpyrazol-3-yl)methyl]pentanoic acid;hydrochloride |
| InChIKey | OVFFVXSEFWSKSF-UHFFFAOYSA-N |
| SMILES | CC(C)CC(CC1=NN(C=C1)C(C)C)C(=O)O.Cl |
Computed by PubChem (NCBI)