Products 1864062-71-4
CAS 1864062-71-4 is the registry number for 2-((4-Bromo-1-methyl-1H-pyrazol-3-yl)methyl)-2,3-dihydro-1H-isoindole-1,3-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(4-bromo-1-methylpyrazol-3-yl)methyl]isoindole-1,3-dione (CAS 1864062-71-4) is a chemical compound with the molecular formula C13H10BrN3O2 and a molecular weight of 320.14 g/mol. IUPAC name: 2-[(4-bromo-1-methylpyrazol-3-yl)methyl]isoindole-1,3-dione. InChIKey: IYOVLWKSZFUTLD-UHFFFAOYSA-N.
| Molecular formula | C13H10BrN3O2 |
|---|---|
| Molecular weight | 320.14 g/mol |
| IUPAC name | 2-[(4-bromo-1-methylpyrazol-3-yl)methyl]isoindole-1,3-dione |
| InChIKey | IYOVLWKSZFUTLD-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)CN2C(=O)C3=CC=CC=C3C2=O)Br |
Computed by PubChem (NCBI)