CAS 1864063-19-3 appears in our catalog under these names: Potassium 4-methyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-sulfonate, 95%, Potassium 4-methyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-sulfonate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Potassium 4-methyl-5-(2-phenylethyl)-1,2,4-triazole-3-sulfonate (CAS 1864063-19-3) is a chemical compound with the molecular formula C11H12KN3O3S and a molecular weight of 305.40 g/mol. IUPAC name: potassium 4-methyl-5-(2-phenylethyl)-1,2,4-triazole-3-sulfonate. InChIKey: JHGULWQHROCPCT-UHFFFAOYSA-M.
| Molecular formula | C11H12KN3O3S |
|---|---|
| Molecular weight | 305.40 g/mol |
| IUPAC name | potassium 4-methyl-5-(2-phenylethyl)-1,2,4-triazole-3-sulfonate |
| InChIKey | JHGULWQHROCPCT-UHFFFAOYSA-M |
| SMILES | CN1C(=NN=C1S(=O)(=O)[O-])CCC2=CC=CC=C2.[K+] |
Computed by PubChem (NCBI)