CAS 1864063-59-1 is the registry number for 2-(3-(Pentafluoro-λâ¶-sulfanyl)phenyl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[3-(pentafluoro-lambda6-sulfanyl)phenyl]ethanamine;hydrochloride (CAS 1864063-59-1) is a chemical compound with the molecular formula C8H11ClF5NS and a molecular weight of 283.69 g/mol. IUPAC name: 2-[3-(pentafluoro-lambda6-sulfanyl)phenyl]ethanamine;hydrochloride. InChIKey: URQNRVNMOGGJOU-UHFFFAOYSA-N.
| Molecular formula | C8H11ClF5NS |
|---|---|
| Molecular weight | 283.69 g/mol |
| IUPAC name | 2-[3-(pentafluoro-lambda6-sulfanyl)phenyl]ethanamine;hydrochloride |
| InChIKey | URQNRVNMOGGJOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(F)(F)(F)(F)F)CCN.Cl |
Computed by PubChem (NCBI)