Products 18643-56-6
CAS 18643-56-6 appears in our catalog under these names: p-Benzenedimalononitrile, 98%, 98%, p-Benzenedimalononitrile, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-[4-(dicyanomethyl)phenyl]propanedinitrile (CAS 18643-56-6) is a chemical compound with the molecular formula C12H6N4 and a molecular weight of 206.20 g/mol. IUPAC name: 2-[4-(dicyanomethyl)phenyl]propanedinitrile. InChIKey: WASJFLRMRDGSBD-UHFFFAOYSA-N.
| Molecular formula | C12H6N4 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | 2-[4-(dicyanomethyl)phenyl]propanedinitrile |
| InChIKey | WASJFLRMRDGSBD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C#N)C#N)C(C#N)C#N |
Computed by PubChem (NCBI)