CAS 18646-81-6 appears in our catalog under these names: Thieno(3,2–b)thiophene–2,5–dicarboxylic acid, Thieno(3,2-b)thiophene-2,5-dicarboxylic acid, Thieno[3,2-b]thiophene-2,5-dicarboxylic acid, 95%, 95%, Thieno[3,2-b]thiophene-2,5-dicarboxylic acid, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg, 500mg.
Thieno[3,2-b]thiophene-2,5-dicarboxylic acid (CAS 18646-81-6) is a chemical compound with the molecular formula C8H4O4S2 and a molecular weight of 228.2 g/mol. IUPAC name: thieno[3,2-b]thiophene-2,5-dicarboxylic acid. InChIKey: JMURVZFFOUWCNW-UHFFFAOYSA-N.
| Molecular formula | C8H4O4S2 |
|---|---|
| Molecular weight | 228.2 g/mol |
| IUPAC name | thieno[3,2-b]thiophene-2,5-dicarboxylic acid |
| InChIKey | JMURVZFFOUWCNW-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1SC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)