CAS 1864774-51-5 is the registry number for 2-Chloro-8-methyl-5,6,7,8-tetrahydroquinolin-8-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol (CAS 1864774-51-5) is a chemical compound with the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. IUPAC name: 2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol. InChIKey: YQRXULPVMPCWCT-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol |
| InChIKey | YQRXULPVMPCWCT-UHFFFAOYSA-N |
| SMILES | CC1(CCCC2=C1N=C(C=C2)Cl)O |
Computed by PubChem (NCBI)