Products 1864884-44-5
CAS 1864884-44-5 is the registry number for (2,6-Diisopropylphenyl)hydrazine Hydrochloride, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
[2,6-di(propan-2-yl)phenyl]hydrazine;hydrochloride (CAS 1864884-44-5) is a chemical compound with the molecular formula C12H21ClN2 and a molecular weight of 228.76 g/mol. IUPAC name: [2,6-di(propan-2-yl)phenyl]hydrazine;hydrochloride. InChIKey: ZAETWSNEVIIXPV-UHFFFAOYSA-N.
| Molecular formula | C12H21ClN2 |
|---|---|
| Molecular weight | 228.76 g/mol |
| IUPAC name | [2,6-di(propan-2-yl)phenyl]hydrazine;hydrochloride |
| InChIKey | ZAETWSNEVIIXPV-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)NN.Cl |
Computed by PubChem (NCBI)
Synonyms:
(2,6-Diisopropylphenyl)hydrazine HCl