CAS 1864889-46-2 is the registry number for 4–fluoro AB–BUTINACA. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-(4-fluorobutyl)indazole-3-carboxamide (CAS 1864889-46-2) is a chemical compound with the molecular formula C17H23FN4O2 and a molecular weight of 334.4 g/mol. IUPAC name: N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-(4-fluorobutyl)indazole-3-carboxamide. InChIKey: VOMPUVOJBVRDRY-AWEZNQCLSA-N.
| Molecular formula | C17H23FN4O2 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-(4-fluorobutyl)indazole-3-carboxamide |
| InChIKey | VOMPUVOJBVRDRY-AWEZNQCLSA-N |
| SMILES | CC(C)[C@@H](C(=O)N)NC(=O)C1=NN(C2=CC=CC=C21)CCCCF |
Computed by PubChem (NCBI)