CAS 186498-09-9 appears in our catalog under these names: 1-(4-Bromophenoxy)-2-methyl-2-propanol, 95%, 1,4–Bis(4–bromophenoxy)–2,5–dimethylhexane–2,5–diol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
1-(4-bromophenoxy)-2-methylpropan-2-ol (CAS 186498-09-9) is a chemical compound with the molecular formula C10H13BrO2 and a molecular weight of 245.11 g/mol. IUPAC name: 1-(4-bromophenoxy)-2-methylpropan-2-ol. InChIKey: OQEFXIZFKZLIHQ-UHFFFAOYSA-N.
| Molecular formula | C10H13BrO2 |
|---|---|
| Molecular weight | 245.11 g/mol |
| IUPAC name | 1-(4-bromophenoxy)-2-methylpropan-2-ol |
| InChIKey | OQEFXIZFKZLIHQ-UHFFFAOYSA-N |
| SMILES | CC(C)(COC1=CC=C(C=C1)Br)O |
Computed by PubChem (NCBI)