CAS 186504-25-6 is the registry number for Allyl O-benzyl-N-(tert-butoxycarbonyl)-L-threoninate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Prop-2-enyl (2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybutanoate (CAS 186504-25-6) is a chemical compound with the molecular formula C19H27NO5 and a molecular weight of 349.4 g/mol. IUPAC name: prop-2-enyl (2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybutanoate. InChIKey: WCGYHUTYQIALJY-ZBFHGGJFSA-N.
| Molecular formula | C19H27NO5 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | prop-2-enyl (2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybutanoate |
| InChIKey | WCGYHUTYQIALJY-ZBFHGGJFSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OCC=C)NC(=O)OC(C)(C)C)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)