Products 186541-47-9
CAS 186541-47-9 is the registry number for (1S,5R,6S)-2-oxobicyclo[3.1.0]hexane-6-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(1S,5R,6S)-2-oxobicyclo[3.1.0]hexane-6-carboxylic acid (CAS 186541-47-9) is a chemical compound with the molecular formula C7H8O3 and a molecular weight of 140.14 g/mol. IUPAC name: (1S,5R,6S)-2-oxobicyclo[3.1.0]hexane-6-carboxylic acid. InChIKey: JUIOQBDYJXJVSZ-PUFIMZNGSA-N.
| Molecular formula | C7H8O3 |
|---|---|
| Molecular weight | 140.14 g/mol |
| IUPAC name | (1S,5R,6S)-2-oxobicyclo[3.1.0]hexane-6-carboxylic acid |
| InChIKey | JUIOQBDYJXJVSZ-PUFIMZNGSA-N |
| SMILES | C1CC(=O)[C@H]2[C@@H]1[C@@H]2C(=O)O |
Computed by PubChem (NCBI)