CAS 186544-27-4 appears in our catalog under these names: LY 344864 (S-enantiomer), 98.0%, 98.0%, LY 344864 (S-enantiomer), 98.0%. Offered by: Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mM/1mL, 2 mg, 5 mg.
N-[(6S)-6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-4-fluorobenzamide (CAS 186544-27-4) is a chemical compound with the molecular formula C21H22FN3O and a molecular weight of 351.4 g/mol. IUPAC name: N-[(6S)-6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-4-fluorobenzamide. InChIKey: GKWHICIUSVVNGX-INIZCTEOSA-N.
| Molecular formula | C21H22FN3O |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | N-[(6S)-6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-4-fluorobenzamide |
| InChIKey | GKWHICIUSVVNGX-INIZCTEOSA-N |
| SMILES | CN(C)[C@H]1CCC2=C(C1)C3=C(N2)C=CC(=C3)NC(=O)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)