CAS 186551-69-9 appears in our catalog under these names: tert-Butyl 3-(bromomethyl)-1h-pyrazole-1-carboxylate, 96%, tert–Butyl 3–(bromomethyl)–1H–pyrazole–1–carboxylate, tert-Butyl 3-(bromomethyl)-1H-pyrazole-1-carboxylate 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 50mg.
Tert-butyl 3-(bromomethyl)pyrazole-1-carboxylate (CAS 186551-69-9) is a chemical compound with the molecular formula C9H13BrN2O2 and a molecular weight of 261.12 g/mol. IUPAC name: tert-butyl 3-(bromomethyl)pyrazole-1-carboxylate. InChIKey: PZYLFTPEOMFQFJ-UHFFFAOYSA-N.
| Molecular formula | C9H13BrN2O2 |
|---|---|
| Molecular weight | 261.12 g/mol |
| IUPAC name | tert-butyl 3-(bromomethyl)pyrazole-1-carboxylate |
| InChIKey | PZYLFTPEOMFQFJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC(=N1)CBr |
Computed by PubChem (NCBI)