CAS 1866-15-5 appears in our catalog under these names: Acetylthiocholine (iodide), Acetylthiocholine iodide, 98%, Acetylthiocholine Iodide, >95% (HPLC), S-Acetylthiocholine iodide, 98% , S-Acetylthiocholine iodide. Offered by: GLPBio, Combi-blocks, TRC, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 5g, 25g, 1g, 10g, 50g, 100g, 250g, 500g.
2-acetylsulfanylethyl(trimethyl)azanium iodide (CAS 1866-15-5) is a chemical compound with the molecular formula C7H16INOS and a molecular weight of 289.18 g/mol. IUPAC name: 2-acetylsulfanylethyl(trimethyl)azanium iodide. InChIKey: NTBLZMAMTZXLBP-UHFFFAOYSA-M.
| Molecular formula | C7H16INOS |
|---|---|
| Molecular weight | 289.18 g/mol |
| IUPAC name | 2-acetylsulfanylethyl(trimethyl)azanium iodide |
| InChIKey | NTBLZMAMTZXLBP-UHFFFAOYSA-M |
| SMILES | CC(=O)SCC[N+](C)(C)C.[I-] |
Computed by PubChem (NCBI)