CAS 1866-16-6 appears in our catalog under these names: S-Butyrylthiocholine iodide, 98%, S801862, S-Butyrylthiocholine iodide, 98% , Butyrylthiocholine iodide, 97.50%, S-Butyrylthiocholine iodide. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Chemat, Biosynth. Available pack sizes: 1g, 25g, 5g, 50g, 100g, 250g, 500g, 1KG.
2-butanoylsulfanylethyl(trimethyl)azanium iodide (CAS 1866-16-6) is a chemical compound with the molecular formula C9H20INOS and a molecular weight of 317.23 g/mol. IUPAC name: 2-butanoylsulfanylethyl(trimethyl)azanium iodide. InChIKey: WEQAAFZDJROSBF-UHFFFAOYSA-M.
| Molecular formula | C9H20INOS |
|---|---|
| Molecular weight | 317.23 g/mol |
| IUPAC name | 2-butanoylsulfanylethyl(trimethyl)azanium iodide |
| InChIKey | WEQAAFZDJROSBF-UHFFFAOYSA-M |
| SMILES | CCCC(=O)SCC[N+](C)(C)C.[I-] |
Computed by PubChem (NCBI)