Products 1866646-24-3
CAS 1866646-24-3 is the registry number for 1-(3-Bromo-2-fluorophenyl)-1,2-ethanediol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3-bromo-2-fluorophenyl)ethane-1,2-diol (CAS 1866646-24-3) is a chemical compound with the molecular formula C8H8BrFO2 and a molecular weight of 235.05 g/mol. IUPAC name: 1-(3-bromo-2-fluorophenyl)ethane-1,2-diol. InChIKey: SLWLENVSBZZTPO-UHFFFAOYSA-N.
| Molecular formula | C8H8BrFO2 |
|---|---|
| Molecular weight | 235.05 g/mol |
| IUPAC name | 1-(3-bromo-2-fluorophenyl)ethane-1,2-diol |
| InChIKey | SLWLENVSBZZTPO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)C(CO)O |
Computed by PubChem (NCBI)