CAS 1866918-35-5 appears in our catalog under these names: (5-Bromo-2-(2,2,2-trifluoroethoxy)pyridin-4-yl)methanol, 95%, (5-Bromo-2-(2,2,2-trifluoroethoxy)pyridin-4-yl)methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
[5-bromo-2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methanol (CAS 1866918-35-5) is a chemical compound with the molecular formula C8H7BrF3NO2 and a molecular weight of 286.05 g/mol. IUPAC name: [5-bromo-2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methanol. InChIKey: LLVWAHWFFHKOEZ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3NO2 |
|---|---|
| Molecular weight | 286.05 g/mol |
| IUPAC name | [5-bromo-2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methanol |
| InChIKey | LLVWAHWFFHKOEZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1OCC(F)(F)F)Br)CO |
Computed by PubChem (NCBI)