CAS 186698-58-8 appears in our catalog under these names: H–D–Tyr(tBu)–OH, H-D-Tyr(tBu)-OH, O-tert-Butyl-D-tyrosine, H-D-Tyr(tBu)-OH, 97%, 97%, H-D-Tyr(tBu)-OH, 98%. Offered by: GLPBio, Iris Biotech, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg, 10g.
(2R)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid (CAS 186698-58-8) is a chemical compound with the molecular formula C13H19NO3 and a molecular weight of 237.29 g/mol. IUPAC name: (2R)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid. InChIKey: SNZIFNXFAFKRKT-LLVKDONJSA-N.
| Molecular formula | C13H19NO3 |
|---|---|
| Molecular weight | 237.29 g/mol |
| IUPAC name | (2R)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid |
| InChIKey | SNZIFNXFAFKRKT-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)